C25H31N5O5S — CID 170163388
[6-[4-(hydroxymethyl)anilino]-5-[6-(2-methylsulfanylpyrimidin-5-yl)hex-5-ynoylamino]-6-oxohexyl]carbamic acid (PubChem CID 170163388) has the molecular formula C25H31N5O5S and a molecular weight of 513.62 g/mol. Its IUPAC name is [6-[4-(hydroxymethyl)anilino]-5-[6-(2-methylsulfanylpyrimidin-5-yl)hex-5-ynoylamino]-6-oxohexyl]carbamic acid.
| Compound Name | [6-[4-(hydroxymethyl)anilino]-5-[6-(2-methylsulfanylpyrimidin-5-yl)hex-5-ynoylamino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 170163388 |
| Molecular Formula | C25H31N5O5S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | [6-[4-(hydroxymethyl)anilino]-5-[6-(2-methylsulfanylpyrimidin-5-yl)hex-5-ynoylamino]-6-oxohexyl]carbamic acid |
| SMILES | CSc1ncc(C#CCCCC(=O)NC(CCCCNC(=O)O)C(=O)Nc2ccc(CO)cc2)cn1 |
| InChI | InChI=1S/C25H31N5O5S/c1-36-24-27-15-19(16-28-24)7-3-2-4-9-22(32)30-21(8-5-6-14-26-25(34)35)23(33)29-20-12-10-18(17-31)11-13-20/h10-13,15-16,21,26,31H,2,4-6,8-9,14,17H2,1H3,(H,29,33)(H,30,32)(H,34,35) |
| InChIKey | WHZZFTRFRHEFFW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 153.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|