C10H11Cl2N3O3 — CID 170219148
3-amino-2,6-dichloro-N-(4-hydroxyoxolan-3-yl)pyridine-4-carboxamide (PubChem CID 170219148) has the molecular formula C10H11Cl2N3O3 and a molecular weight of 292.12 g/mol. Its IUPAC name is 3-amino-2,6-dichloro-N-(4-hydroxyoxolan-3-yl)pyridine-4-carboxamide.
| Compound Name | 3-amino-2,6-dichloro-N-(4-hydroxyoxolan-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 170219148 |
| Molecular Formula | C10H11Cl2N3O3 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 3-amino-2,6-dichloro-N-(4-hydroxyoxolan-3-yl)pyridine-4-carboxamide |
| SMILES | Nc1c(C(=O)NC2COCC2O)cc(Cl)nc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O3/c11-7-1-4(8(13)9(12)15-7)10(17)14-5-2-18-3-6(5)16/h1,5-6,16H,2-3,13H2,(H,14,17) |
| InChIKey | XMRGASJENMSODX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|