C28H38N5O6P — CID 170220144
2-[[[(1S,2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3-dihydroxy-1-methylcyclopentyl]methyl-phenoxyphosphoryl]amino]ethyl cyclohexanecarboxylate (PubChem CID 170220144) has the molecular formula C28H38N5O6P and a molecular weight of 571.62 g/mol. Its IUPAC name is 2-[[[(1S,2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3-dihydroxy-1-methylcyclopentyl]methyl-phenoxyphosphoryl]amino]ethyl cyclohexanecarboxylate.
| Compound Name | 2-[[[(1S,2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3-dihydroxy-1-methylcyclopentyl]methyl-phenoxyphosphoryl]amino]ethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 170220144 |
| Molecular Formula | C28H38N5O6P |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | 2-[[[(1S,2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3-dihydroxy-1-methylcyclopentyl]methyl-phenoxyphosphoryl]amino]ethyl cyclohexanecarboxylate |
| SMILES | C[C@]1(CP(=O)(NCCOC(=O)C2CCCCC2)Oc2ccccc2)C[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H38N5O6P/c1-28(16-21(24(34)25(28)35)22-12-13-23-26(29)30-18-31-33(22)23)17-40(37,39-20-10-6-3-7-11-20)32-14-15-38-27(36)19-8-4-2-5-9-19/h3,6-7,10-13,18-19,21,24-25,34-35H,2,4-5,8-9,14-17H2,1H3,(H,32,37)(H2,29,30,31)/t21-,24-,25-,28+,40?/m0/s1 |
| InChIKey | CYLSNMJWSHNCJP-IQBZRMMVSA-N |
| XLogP | 3.51 |
| TPSA | 161.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|