C11H11Cl2NO — CID 170229352
(1Z)-1-(2,3-dichlorophenyl)-3-methoxybuta-1,3-dien-2-amine (PubChem CID 170229352) has the molecular formula C11H11Cl2NO and a molecular weight of 244.12 g/mol. Its IUPAC name is (1Z)-1-(2,3-dichlorophenyl)-3-methoxybuta-1,3-dien-2-amine.
| Compound Name | (1Z)-1-(2,3-dichlorophenyl)-3-methoxybuta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 170229352 |
| Molecular Formula | C11H11Cl2NO |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | (1Z)-1-(2,3-dichlorophenyl)-3-methoxybuta-1,3-dien-2-amine |
| SMILES | C=C(OC)/C(N)=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl2NO/c1-7(15-2)10(14)6-8-4-3-5-9(12)11(8)13/h3-6H,1,14H2,2H3/b10-6- |
| InChIKey | TWVHQOWPLTZAEM-POHAHGRESA-N |
| XLogP | 3.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|