C32H50O10 — CID 170237410
[5,6-dihydroxy-4-(hydroxymethyl)-8-methoxy-7,9,12,12-tetramethyl-10-[(E)-2-methylbut-2-enoyl]oxy-6-(2-methylpropanoyl)-3-oxatetracyclo[6.5.0.02,4.011,13]tridecan-11-yl] 2-methylbutanoate (PubChem CID 170237410) has the molecular formula C32H50O10 and a molecular weight of 594.74 g/mol. Its IUPAC name is [5,6-dihydroxy-4-(hydroxymethyl)-8-methoxy-7,9,12,12-tetramethyl-10-[(E)-2-methylbut-2-enoyl]oxy-6-(2-methylpropanoyl)-3-oxatetracyclo[6.5.0.02,4.011,13]tridecan-11-yl] 2-methylbutanoate.
| Compound Name | [5,6-dihydroxy-4-(hydroxymethyl)-8-methoxy-7,9,12,12-tetramethyl-10-[(E)-2-methylbut-2-enoyl]oxy-6-(2-methylpropanoyl)-3-oxatetracyclo[6.5.0.02,4.011,13]tridecan-11-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 170237410 |
| Molecular Formula | C32H50O10 |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | [5,6-dihydroxy-4-(hydroxymethyl)-8-methoxy-7,9,12,12-tetramethyl-10-[(E)-2-methylbut-2-enoyl]oxy-6-(2-methylpropanoyl)-3-oxatetracyclo[6.5.0.02,4.011,13]tridecan-11-yl] 2-methylbutanoate |
| SMILES | C/C=C(\C)C(=O)OC1C(C)C2(OC)C(C3OC3(CO)C(O)C(O)(C(=O)C(C)C)C2C)C2C(C)(C)C12OC(=O)C(C)CC |
| InChI | InChI=1S/C32H50O10/c1-12-16(5)25(35)40-23-18(7)31(39-11)19(8)30(38,22(34)15(3)4)27(37)29(14-33)24(41-29)20(31)21-28(9,10)32(21,23)42-26(36)17(6)13-2/h12,15,17-21,23-24,27,33,37-38H,13-14H2,1-11H3/b16-12+ |
| InChIKey | JRTXMAFQBCFWAQ-FOWTUZBSSA-N |
| XLogP | 2.60 |
| TPSA | 152.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|