C29H39N9O2 — CID 170251541
(Z)-4-[[2-[4-(2,7-diazaspiro[3.4]octan-2-yl)-3-methylanilino]-5-formylpyrimidin-4-yl]-[methyl(prop-2-enyl)amino]amino]-4-imino-N-propan-2-ylbut-2-enamide (PubChem CID 170251541) has the molecular formula C29H39N9O2 and a molecular weight of 545.69 g/mol. Its IUPAC name is (Z)-4-[[2-[4-(2,7-diazaspiro[3.4]octan-2-yl)-3-methylanilino]-5-formylpyrimidin-4-yl]-[methyl(prop-2-enyl)amino]amino]-4-imino-N-propan-2-ylbut-2-enamide.
| Compound Name | (Z)-4-[[2-[4-(2,7-diazaspiro[3.4]octan-2-yl)-3-methylanilino]-5-formylpyrimidin-4-yl]-[methyl(prop-2-enyl)amino]amino]-4-imino-N-propan-2-ylbut-2-enamide |
|---|---|
| PubChem CID | 170251541 |
| Molecular Formula | C29H39N9O2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.32 |
| IUPAC Name | (Z)-4-[[2-[4-(2,7-diazaspiro[3.4]octan-2-yl)-3-methylanilino]-5-formylpyrimidin-4-yl]-[methyl(prop-2-enyl)amino]amino]-4-imino-N-propan-2-ylbut-2-enamide |
| SMILES | [H]/N=C(/C=C\C(=O)NC(C)C)N(c1nc(Nc2ccc(N3CC4(CCNC4)C3)c(C)c2)ncc1C=O)N(C)CC=C |
| InChI | InChI=1S/C29H39N9O2/c1-6-13-36(5)38(25(30)9-10-26(40)33-20(2)3)27-22(16-39)15-32-28(35-27)34-23-7-8-24(21(4)14-23)37-18-29(19-37)11-12-31-17-29/h6-10,14-16,20,30-31H,1,11-13,17-19H2,2-5H3,(H,33,40)(H,32,34,35)/b10-9-,30-25- |
| InChIKey | CGYLBYSHCPCVFW-HQGFVOCCSA-N |
| XLogP | 3.04 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|