C29H39F2N9O2 — CID 170251217
(Z)-N-[2-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]anilino]-5-formylpyrimidin-4-yl]-N'-[methyl(propan-2-yl)amino]-N-[methyl(prop-2-enyl)amino]-4-oxobut-2-enimidamide (PubChem CID 170251217) has the molecular formula C29H39F2N9O2 and a molecular weight of 583.69 g/mol. Its IUPAC name is (Z)-N-[2-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]anilino]-5-formylpyrimidin-4-yl]-N'-[methyl(propan-2-yl)amino]-N-[methyl(prop-2-enyl)amino]-4-oxobut-2-enimidamide.
| Compound Name | (Z)-N-[2-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]anilino]-5-formylpyrimidin-4-yl]-N'-[methyl(propan-2-yl)amino]-N-[methyl(prop-2-enyl)amino]-4-oxobut-2-enimidamide |
|---|---|
| PubChem CID | 170251217 |
| Molecular Formula | C29H39F2N9O2 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.32 |
| IUPAC Name | (Z)-N-[2-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]anilino]-5-formylpyrimidin-4-yl]-N'-[methyl(propan-2-yl)amino]-N-[methyl(prop-2-enyl)amino]-4-oxobut-2-enimidamide |
| SMILES | C=CCN(C)N(C(/C=C\C=O)=N/N(C)C(C)C)c1nc(Nc2ccc(N3CCN(CC(F)F)CC3)cc2)ncc1C=O |
| InChI | InChI=1S/C29H39F2N9O2/c1-6-13-36(4)40(27(8-7-18-41)35-37(5)22(2)3)28-23(21-42)19-32-29(34-28)33-24-9-11-25(12-10-24)39-16-14-38(15-17-39)20-26(30)31/h6-12,18-19,21-22,26H,1,13-17,20H2,2-5H3,(H,32,33,34)/b8-7-,35-27+ |
| InChIKey | GKGWRBZYCHDAEB-KUFXMGOTSA-N |
| XLogP | 3.67 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|