C30H38N6O3 — CID 87381383
2-[1-[4-[[4-(benzylamino)-5-formylpyrimidin-2-yl]amino]phenyl]piperidin-4-yl]ethyl-tert-butylcarbamic acid (PubChem CID 87381383) has the molecular formula C30H38N6O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2-[1-[4-[[4-(benzylamino)-5-formylpyrimidin-2-yl]amino]phenyl]piperidin-4-yl]ethyl-tert-butylcarbamic acid.
| Compound Name | 2-[1-[4-[[4-(benzylamino)-5-formylpyrimidin-2-yl]amino]phenyl]piperidin-4-yl]ethyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 87381383 |
| Molecular Formula | C30H38N6O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 2-[1-[4-[[4-(benzylamino)-5-formylpyrimidin-2-yl]amino]phenyl]piperidin-4-yl]ethyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CCC1CCN(c2ccc(Nc3ncc(C=O)c(NCc4ccccc4)n3)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C30H38N6O3/c1-30(2,3)36(29(38)39)18-15-22-13-16-35(17-14-22)26-11-9-25(10-12-26)33-28-32-20-24(21-37)27(34-28)31-19-23-7-5-4-6-8-23/h4-12,20-22H,13-19H2,1-3H3,(H,38,39)(H2,31,32,33,34) |
| InChIKey | GUZHUOKYHMTYPX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|