C14H17ClN2O — CID 170254757
(8S)-2-chloro-8-ethyl-5-methyl-5-prop-2-enyl-6,8-dihydro-1,6-naphthyridin-7-one (PubChem CID 170254757) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is (8S)-2-chloro-8-ethyl-5-methyl-5-prop-2-enyl-6,8-dihydro-1,6-naphthyridin-7-one.
| Compound Name | (8S)-2-chloro-8-ethyl-5-methyl-5-prop-2-enyl-6,8-dihydro-1,6-naphthyridin-7-one |
|---|---|
| PubChem CID | 170254757 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (8S)-2-chloro-8-ethyl-5-methyl-5-prop-2-enyl-6,8-dihydro-1,6-naphthyridin-7-one |
| SMILES | C=CCC1(C)NC(=O)[C@@H](CC)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C14H17ClN2O/c1-4-8-14(3)10-6-7-11(15)16-12(10)9(5-2)13(18)17-14/h4,6-7,9H,1,5,8H2,2-3H3,(H,17,18)/t9-,14?/m0/s1 |
| InChIKey | NJYWOWWEBBSHBV-CUVJYRNJSA-N |
| XLogP | 3.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|