C33H30O5 — CID 170291298
2-[4-[3-ethynyl-1-[4-(2-hydroxyethoxy)phenyl]-2-[(Z)-prop-1-enyl]inden-1-yl]phenoxy]ethyl prop-2-enoate (PubChem CID 170291298) has the molecular formula C33H30O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is 2-[4-[3-ethynyl-1-[4-(2-hydroxyethoxy)phenyl]-2-[(Z)-prop-1-enyl]inden-1-yl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[3-ethynyl-1-[4-(2-hydroxyethoxy)phenyl]-2-[(Z)-prop-1-enyl]inden-1-yl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 170291298 |
| Molecular Formula | C33H30O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 2-[4-[3-ethynyl-1-[4-(2-hydroxyethoxy)phenyl]-2-[(Z)-prop-1-enyl]inden-1-yl]phenoxy]ethyl prop-2-enoate |
| SMILES | C#CC1=C(/C=C\C)C(c2ccc(OCCO)cc2)(c2ccc(OCCOC(=O)C=C)cc2)c2ccccc21 |
| InChI | InChI=1S/C33H30O5/c1-4-9-30-28(5-2)29-10-7-8-11-31(29)33(30,24-12-16-26(17-13-24)36-21-20-34)25-14-18-27(19-15-25)37-22-23-38-32(35)6-3/h2,4,6-19,34H,3,20-23H2,1H3/b9-4- |
| InChIKey | ZFYBUNLWABWQGN-WTKPLQERSA-N |
| XLogP | 5.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|