C26H33FO5 — CID 170304942
2-[(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)oxolan-3-yl]-2,3,3-trimethylbutanoic acid (PubChem CID 170304942) has the molecular formula C26H33FO5 and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-[(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)oxolan-3-yl]-2,3,3-trimethylbutanoic acid.
| Compound Name | 2-[(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)oxolan-3-yl]-2,3,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 170304942 |
| Molecular Formula | C26H33FO5 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 2-[(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)oxolan-3-yl]-2,3,3-trimethylbutanoic acid |
| SMILES | COc1ccc(C[C@H]2CO[C@H](c3ccc(F)cc3)[C@H]2C(C)(C(=O)O)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C26H33FO5/c1-25(2,3)26(4,24(28)29)22-18(13-16-7-12-20(30-5)21(14-16)31-6)15-32-23(22)17-8-10-19(27)11-9-17/h7-12,14,18,22-23H,13,15H2,1-6H3,(H,28,29)/t18-,22-,23+,26?/m0/s1 |
| InChIKey | JEXIPALWILINDR-UWTDUBSPSA-N |
| XLogP | 5.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |