C10H10BrNO3 — CID 170334927
6-bromo-5-methoxy-4-methyl-1,4-benzoxazin-3-one (PubChem CID 170334927) has the molecular formula C10H10BrNO3 and a molecular weight of 272.10 g/mol. Its IUPAC name is 6-bromo-5-methoxy-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-bromo-5-methoxy-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 170334927 |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 6-bromo-5-methoxy-4-methyl-1,4-benzoxazin-3-one |
| SMILES | COc1c(Br)ccc2c1N(C)C(=O)CO2 |
| InChI | InChI=1S/C10H10BrNO3/c1-12-8(13)5-15-7-4-3-6(11)10(14-2)9(7)12/h3-4H,5H2,1-2H3 |
| InChIKey | AXHKMDQBBDBDEJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |