C25H40N4O2 — CID 170355305
N-[5-amino-1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]pentyl]acetamide (PubChem CID 170355305) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is N-[5-amino-1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]pentyl]acetamide.
| Compound Name | N-[5-amino-1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 170355305 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | N-[5-amino-1-[3-(4-decylphenyl)-1,2,4-oxadiazol-5-yl]pentyl]acetamide |
| SMILES | CCCCCCCCCCc1ccc(-c2noc(C(CCCCN)NC(C)=O)n2)cc1 |
| InChI | InChI=1S/C25H40N4O2/c1-3-4-5-6-7-8-9-10-13-21-15-17-22(18-16-21)24-28-25(31-29-24)23(27-20(2)30)14-11-12-19-26/h15-18,23H,3-14,19,26H2,1-2H3,(H,27,30) |
| InChIKey | AWGZTUGARQIMRD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|