C9H6N2S — CID 170363466
1H-2,3-benzothiazine-6-carbonitrile (PubChem CID 170363466) has the molecular formula C9H6N2S and a molecular weight of 174.23 g/mol. Its IUPAC name is 1H-2,3-benzothiazine-6-carbonitrile.
| Compound Name | 1H-2,3-benzothiazine-6-carbonitrile |
|---|---|
| PubChem CID | 170363466 |
| Molecular Formula | C9H6N2S |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 1H-2,3-benzothiazine-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C=NSC2 |
| InChI | InChI=1S/C9H6N2S/c10-4-7-1-2-8-6-12-11-5-9(8)3-7/h1-3,5H,6H2 |
| InChIKey | UZGOORRYCPQZSL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|