C10H11NO4 — CID 170396627
4-[(1E)-2,3-dihydroxybuta-1,3-dienyl]-5-methyl-3H-pyridine-2,6-dione (PubChem CID 170396627) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 4-[(1E)-2,3-dihydroxybuta-1,3-dienyl]-5-methyl-3H-pyridine-2,6-dione.
| Compound Name | 4-[(1E)-2,3-dihydroxybuta-1,3-dienyl]-5-methyl-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 170396627 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 4-[(1E)-2,3-dihydroxybuta-1,3-dienyl]-5-methyl-3H-pyridine-2,6-dione |
| SMILES | C=C(O)/C(O)=C\C1=C(C)C(=O)NC(=O)C1 |
| InChI | InChI=1S/C10H11NO4/c1-5-7(3-8(13)6(2)12)4-9(14)11-10(5)15/h3,12-13H,2,4H2,1H3,(H,11,14,15)/b8-3+ |
| InChIKey | AZRWXDYDZWFFDO-FPYGCLRLSA-N |
| XLogP | 0.86 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|