C36H10N10O — CID 170402807
2-[(E)-cyano-[(9E)-9-[cyano-(2,4,6-tricyanophenyl)methylidene]furo[3,2-f][4,7]phenanthrolin-6-ylidene]methyl]benzene-1,3,5-tricarbonitrile (PubChem CID 170402807) has the molecular formula C36H10N10O and a molecular weight of 598.55 g/mol. Its IUPAC name is 2-[(E)-cyano-[(9E)-9-[cyano-(2,4,6-tricyanophenyl)methylidene]furo[3,2-f][4,7]phenanthrolin-6-ylidene]methyl]benzene-1,3,5-tricarbonitrile.
| Compound Name | 2-[(E)-cyano-[(9E)-9-[cyano-(2,4,6-tricyanophenyl)methylidene]furo[3,2-f][4,7]phenanthrolin-6-ylidene]methyl]benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 170402807 |
| Molecular Formula | C36H10N10O |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | 2-[(E)-cyano-[(9E)-9-[cyano-(2,4,6-tricyanophenyl)methylidene]furo[3,2-f][4,7]phenanthrolin-6-ylidene]methyl]benzene-1,3,5-tricarbonitrile |
| SMILES | N#C/C(c1c(C#N)cc(C#N)cc1C#N)=c1/cnc2c(c1)c1c/c(=C(\C#N)c3c(C#N)cc(C#N)cc3C#N)cnc1c1occc21 |
| InChI | InChI=1S/C36H10N10O/c37-9-19-3-21(11-39)32(22(4-19)12-40)30(15-43)25-7-28-29-8-26(18-46-35(29)36-27(1-2-47-36)34(28)45-17-25)31(16-44)33-23(13-41)5-20(10-38)6-24(33)14-42/h1-8,17-18H/b30-25-,31-26- |
| InChIKey | KJRKOWAKCDIOCY-FNBNKOJXSA-N |
| XLogP | 4.20 |
| TPSA | 229.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|