C8H18N2O3 — CID 170422913
N',N'-bis(2-hydroxyethyl)butanehydrazide (PubChem CID 170422913) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is N',N'-bis(2-hydroxyethyl)butanehydrazide.
| Compound Name | N',N'-bis(2-hydroxyethyl)butanehydrazide |
|---|---|
| PubChem CID | 170422913 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | N',N'-bis(2-hydroxyethyl)butanehydrazide |
| SMILES | CCCC(=O)NN(CCO)CCO |
| InChI | InChI=1S/C8H18N2O3/c1-2-3-8(13)9-10(4-6-11)5-7-12/h11-12H,2-7H2,1H3,(H,9,13) |
| InChIKey | BIPVTYYWNFEYDW-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|