C49H37N3O — CID 170423246
N'-benzyl-N-[1-(methylideneamino)-2-[2-[(1E)-2-phenanthren-2-ylbuta-1,3-dienyl]-1-benzofuran-3-yl]ethylidene]-4-phenylbenzenecarboximidamide (PubChem CID 170423246) has the molecular formula C49H37N3O and a molecular weight of 683.86 g/mol. Its IUPAC name is N'-benzyl-N-[1-(methylideneamino)-2-[2-[(1E)-2-phenanthren-2-ylbuta-1,3-dienyl]-1-benzofuran-3-yl]ethylidene]-4-phenylbenzenecarboximidamide.
| Compound Name | N'-benzyl-N-[1-(methylideneamino)-2-[2-[(1E)-2-phenanthren-2-ylbuta-1,3-dienyl]-1-benzofuran-3-yl]ethylidene]-4-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 170423246 |
| Molecular Formula | C49H37N3O |
| Molecular Weight | 683.86 g/mol |
| Exact Mass | 683.29 |
| IUPAC Name | N'-benzyl-N-[1-(methylideneamino)-2-[2-[(1E)-2-phenanthren-2-ylbuta-1,3-dienyl]-1-benzofuran-3-yl]ethylidene]-4-phenylbenzenecarboximidamide |
| SMILES | C=C/C(=C\c1oc2ccccc2c1C/C(N=C)=N/C(=N/Cc1ccccc1)c1ccc(-c2ccccc2)cc1)c1ccc2c(ccc3ccccc32)c1 |
| InChI | InChI=1S/C49H37N3O/c1-3-35(40-28-29-43-41(30-40)27-24-38-18-10-11-19-42(38)43)31-47-45(44-20-12-13-21-46(44)53-47)32-48(50-2)52-49(51-33-34-14-6-4-7-15-34)39-25-22-37(23-26-39)36-16-8-5-9-17-36/h3-31H,1-2,32-33H2/b35-31+,51-49+,52-48- |
| InChIKey | CIEWUTDXGIBSKC-KEJMBRQQSA-N |
| XLogP | 12.42 |
| TPSA | 50.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.86 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|