C28H27BrClN3O5 — CID 170424758
benzyl N-[(4S)-4-[(3-bromobenzoyl)amino]-5-[[2-(4-chlorophenyl)-2-oxoethyl]amino]-5-oxopentyl]carbamate (PubChem CID 170424758) has the molecular formula C28H27BrClN3O5 and a molecular weight of 600.90 g/mol. Its IUPAC name is benzyl N-[(4S)-4-[(3-bromobenzoyl)amino]-5-[[2-(4-chlorophenyl)-2-oxoethyl]amino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[(4S)-4-[(3-bromobenzoyl)amino]-5-[[2-(4-chlorophenyl)-2-oxoethyl]amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 170424758 |
| Molecular Formula | C28H27BrClN3O5 |
| Molecular Weight | 600.90 g/mol |
| Exact Mass | 599.08 |
| IUPAC Name | benzyl N-[(4S)-4-[(3-bromobenzoyl)amino]-5-[[2-(4-chlorophenyl)-2-oxoethyl]amino]-5-oxopentyl]carbamate |
| SMILES | O=C(NCCC[C@H](NC(=O)c1cccc(Br)c1)C(=O)NCC(=O)c1ccc(Cl)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C28H27BrClN3O5/c29-22-9-4-8-21(16-22)26(35)33-24(27(36)32-17-25(34)20-11-13-23(30)14-12-20)10-5-15-31-28(37)38-18-19-6-2-1-3-7-19/h1-4,6-9,11-14,16,24H,5,10,15,17-18H2,(H,31,37)(H,32,36)(H,33,35)/t24-/m0/s1 |
| InChIKey | OSHCLCORMVDCIT-DEOSSOPVSA-N |
| XLogP | 4.91 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.90 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|