C25H26ClN3O5 — CID 97312246
methyl (2R)-2-[[5-(4-chlorophenyl)-1H-pyrrole-2-carbonyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 97312246) has the molecular formula C25H26ClN3O5 and a molecular weight of 483.95 g/mol. Its IUPAC name is methyl (2R)-2-[[5-(4-chlorophenyl)-1H-pyrrole-2-carbonyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl (2R)-2-[[5-(4-chlorophenyl)-1H-pyrrole-2-carbonyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 97312246 |
| Molecular Formula | C25H26ClN3O5 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | methyl (2R)-2-[[5-(4-chlorophenyl)-1H-pyrrole-2-carbonyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)[C@@H](CCCNC(=O)OCc1ccccc1)NC(=O)c1ccc(-c2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C25H26ClN3O5/c1-33-24(31)22(8-5-15-27-25(32)34-16-17-6-3-2-4-7-17)29-23(30)21-14-13-20(28-21)18-9-11-19(26)12-10-18/h2-4,6-7,9-14,22,28H,5,8,15-16H2,1H3,(H,27,32)(H,29,30)/t22-/m1/s1 |
| InChIKey | NPICLICMSAKZBG-JOCHJYFZSA-N |
| XLogP | 4.31 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|