C15H16Cl2N2O4 — CID 170427622
[6,7-dichloro-2-(oxan-2-yloxymethyl)-1H-indol-4-yl]carbamic acid (PubChem CID 170427622) has the molecular formula C15H16Cl2N2O4 and a molecular weight of 359.21 g/mol. Its IUPAC name is [6,7-dichloro-2-(oxan-2-yloxymethyl)-1H-indol-4-yl]carbamic acid.
| Compound Name | [6,7-dichloro-2-(oxan-2-yloxymethyl)-1H-indol-4-yl]carbamic acid |
|---|---|
| PubChem CID | 170427622 |
| Molecular Formula | C15H16Cl2N2O4 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | [6,7-dichloro-2-(oxan-2-yloxymethyl)-1H-indol-4-yl]carbamic acid |
| SMILES | O=C(O)Nc1cc(Cl)c(Cl)c2[nH]c(COC3CCCCO3)cc12 |
| InChI | InChI=1S/C15H16Cl2N2O4/c16-10-6-11(19-15(20)21)9-5-8(18-14(9)13(10)17)7-23-12-3-1-2-4-22-12/h5-6,12,18-19H,1-4,7H2,(H,20,21) |
| InChIKey | ASIYHEJLGLKPDQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |