C13H20N4O5S — CID 17052295
(Z)-methoxyimino-[2-[3-[(4-methylphenyl)sulfonylamino]propylamino]-2-oxoethyl]-oxidoazanium (PubChem CID 17052295) has the molecular formula C13H20N4O5S and a molecular weight of 344.39 g/mol. Its IUPAC name is (Z)-methoxyimino-[2-[3-[(4-methylphenyl)sulfonylamino]propylamino]-2-oxoethyl]-oxidoazanium.
| Compound Name | (Z)-methoxyimino-[2-[3-[(4-methylphenyl)sulfonylamino]propylamino]-2-oxoethyl]-oxidoazanium |
|---|---|
| PubChem CID | 17052295 |
| Molecular Formula | C13H20N4O5S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (Z)-methoxyimino-[2-[3-[(4-methylphenyl)sulfonylamino]propylamino]-2-oxoethyl]-oxidoazanium |
| SMILES | CO/N=[N+](\[O-])CC(=O)NCCCNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H20N4O5S/c1-11-4-6-12(7-5-11)23(20,21)15-9-3-8-14-13(18)10-17(19)16-22-2/h4-7,15H,3,8-10H2,1-2H3,(H,14,18)/b17-16- |
| InChIKey | IWWARAACOMWBEX-MSUUIHNZSA-N |
| XLogP | 0.30 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|