C31H36FN5O7 — CID 170549639
N-[[1-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]piperidin-3-yl]methyl]-2-fluoro-5-methoxybenzamide (PubChem CID 170549639) has the molecular formula C31H36FN5O7 and a molecular weight of 609.66 g/mol. Its IUPAC name is N-[[1-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]piperidin-3-yl]methyl]-2-fluoro-5-methoxybenzamide.
| Compound Name | N-[[1-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]piperidin-3-yl]methyl]-2-fluoro-5-methoxybenzamide |
|---|---|
| PubChem CID | 170549639 |
| Molecular Formula | C31H36FN5O7 |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | N-[[1-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]piperidin-3-yl]methyl]-2-fluoro-5-methoxybenzamide |
| SMILES | COc1ccc(F)c(C(=O)NCC2CCCN(CCOCCNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)c1 |
| InChI | InChI=1S/C31H36FN5O7/c1-43-20-7-8-23(32)22(16-20)28(39)34-17-19-4-3-12-36(18-19)13-15-44-14-11-33-24-6-2-5-21-27(24)31(42)37(30(21)41)25-9-10-26(38)35-29(25)40/h2,5-8,16,19,25,33H,3-4,9-15,17-18H2,1H3,(H,34,39)(H,35,38,40) |
| InChIKey | JUJNUUVAJDLJDA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|