C31H37FN6O7 — CID 175196211
3-amino-N-[[1-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]piperidin-2-yl]methyl]-2-fluoro-5-methoxybenzamide (PubChem CID 175196211) has the molecular formula C31H37FN6O7 and a molecular weight of 624.67 g/mol. Its IUPAC name is 3-amino-N-[[1-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]piperidin-2-yl]methyl]-2-fluoro-5-methoxybenzamide.
| Compound Name | 3-amino-N-[[1-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]piperidin-2-yl]methyl]-2-fluoro-5-methoxybenzamide |
|---|---|
| PubChem CID | 175196211 |
| Molecular Formula | C31H37FN6O7 |
| Molecular Weight | 624.67 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | 3-amino-N-[[1-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]piperidin-2-yl]methyl]-2-fluoro-5-methoxybenzamide |
| SMILES | COc1cc(N)c(F)c(C(=O)NCC2CCCCN2CCOCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C31H37FN6O7/c1-44-19-15-21(27(32)22(33)16-19)28(40)35-17-18-5-2-3-11-37(18)12-14-45-13-10-34-23-7-4-6-20-26(23)31(43)38(30(20)42)24-8-9-25(39)36-29(24)41/h4,6-7,15-16,18,24,34H,2-3,5,8-14,17,33H2,1H3,(H,35,40)(H,36,39,41) |
| InChIKey | DNOONUYWOBWSMH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.67 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|