C31H34FN7O7 — CID 175183348
3-amino-N-[1-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperazine-1-carbonyl]piperidin-4-yl]-2-fluoro-5-methoxybenzamide (PubChem CID 175183348) has the molecular formula C31H34FN7O7 and a molecular weight of 635.65 g/mol. Its IUPAC name is 3-amino-N-[1-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperazine-1-carbonyl]piperidin-4-yl]-2-fluoro-5-methoxybenzamide.
| Compound Name | 3-amino-N-[1-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperazine-1-carbonyl]piperidin-4-yl]-2-fluoro-5-methoxybenzamide |
|---|---|
| PubChem CID | 175183348 |
| Molecular Formula | C31H34FN7O7 |
| Molecular Weight | 635.65 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | 3-amino-N-[1-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperazine-1-carbonyl]piperidin-4-yl]-2-fluoro-5-methoxybenzamide |
| SMILES | COc1cc(N)c(F)c(C(=O)NC2CCN(C(=O)N3CCN(c4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)c1 |
| InChI | InChI=1S/C31H34FN7O7/c1-46-18-15-20(26(32)21(33)16-18)27(41)34-17-7-9-37(10-8-17)31(45)38-13-11-36(12-14-38)22-4-2-3-19-25(22)30(44)39(29(19)43)23-5-6-24(40)35-28(23)42/h2-4,15-17,23H,5-14,33H2,1H3,(H,34,41)(H,35,40,42) |
| InChIKey | ZFLIZHJPTFJHPH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 174.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.65 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|