C26H40N4O5 — CID 170605965
benzyl N-[6-amino-5-[(1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)oxycarbonylamino]-6-oxohexyl]carbamate (PubChem CID 170605965) has the molecular formula C26H40N4O5 and a molecular weight of 488.63 g/mol. Its IUPAC name is benzyl N-[6-amino-5-[(1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)oxycarbonylamino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[6-amino-5-[(1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)oxycarbonylamino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 170605965 |
| Molecular Formula | C26H40N4O5 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | benzyl N-[6-amino-5-[(1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)oxycarbonylamino]-6-oxohexyl]carbamate |
| SMILES | CC1CC2CC(N)(C1)CC(C)(OC(=O)NC(CCCCNC(=O)OCc1ccccc1)C(N)=O)C2 |
| InChI | InChI=1S/C26H40N4O5/c1-18-12-20-14-25(2,17-26(28,13-18)15-20)35-24(33)30-21(22(27)31)10-6-7-11-29-23(32)34-16-19-8-4-3-5-9-19/h3-5,8-9,18,20-21H,6-7,10-17,28H2,1-2H3,(H2,27,31)(H,29,32)(H,30,33) |
| InChIKey | USXNHCQZFITMPI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|