C14H28N4O4S2 — CID 170627588
acetamide;(2R)-2-acetamido-N-ethyl-3-[[3-(ethylamino)-3-oxopropyl]disulfanyl]propanamide (PubChem CID 170627588) has the molecular formula C14H28N4O4S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is acetamide;(2R)-2-acetamido-N-ethyl-3-[[3-(ethylamino)-3-oxopropyl]disulfanyl]propanamide.
| Compound Name | acetamide;(2R)-2-acetamido-N-ethyl-3-[[3-(ethylamino)-3-oxopropyl]disulfanyl]propanamide |
|---|---|
| PubChem CID | 170627588 |
| Molecular Formula | C14H28N4O4S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | acetamide;(2R)-2-acetamido-N-ethyl-3-[[3-(ethylamino)-3-oxopropyl]disulfanyl]propanamide |
| SMILES | CC(N)=O.CCNC(=O)CCSSC[C@H](NC(C)=O)C(=O)NCC |
| InChI | InChI=1S/C12H23N3O3S2.C2H5NO/c1-4-13-11(17)6-7-19-20-8-10(15-9(3)16)12(18)14-5-2;1-2(3)4/h10H,4-8H2,1-3H3,(H,13,17)(H,14,18)(H,15,16);1H3,(H2,3,4)/t10-;/m0./s1 |
| InChIKey | DVGFCCDJJIMYIX-PPHPATTJSA-N |
| XLogP | 0.03 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|