C18H25N2P+2 — CID 170629076
4,12-ditert-butyl-7,9-diazonia-8-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 170629076) has the molecular formula C18H25N2P+2 and a molecular weight of 300.39 g/mol. Its IUPAC name is 4,12-ditert-butyl-7,9-diazonia-8-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4,12-ditert-butyl-7,9-diazonia-8-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 170629076 |
| Molecular Formula | C18H25N2P+2 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 4,12-ditert-butyl-7,9-diazonia-8-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CC(C)(C)c1cc[n+]2[pH][n+]3ccc(C(C)(C)C)cc3c2c1 |
| InChI | InChI=1S/C18H25N2P/c1-17(2,3)13-7-9-19-15(11-13)16-12-14(18(4,5)6)8-10-20(16)21-19/h7-12,21H,1-6H3/q+2 |
| InChIKey | BVZADJOHOAIQSH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 8.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |