C51H44N2O4 — CID 170691803
4-(4-formyl-N-[6-(4-formyl-N-(4-methoxyphenyl)anilino)-3,8-di(propan-2-yl)pyren-1-yl]anilino)-3-methylbenzaldehyde (PubChem CID 170691803) has the molecular formula C51H44N2O4 and a molecular weight of 748.92 g/mol. Its IUPAC name is 4-(4-formyl-N-[6-(4-formyl-N-(4-methoxyphenyl)anilino)-3,8-di(propan-2-yl)pyren-1-yl]anilino)-3-methylbenzaldehyde.
| Compound Name | 4-(4-formyl-N-[6-(4-formyl-N-(4-methoxyphenyl)anilino)-3,8-di(propan-2-yl)pyren-1-yl]anilino)-3-methylbenzaldehyde |
|---|---|
| PubChem CID | 170691803 |
| Molecular Formula | C51H44N2O4 |
| Molecular Weight | 748.92 g/mol |
| Exact Mass | 748.33 |
| IUPAC Name | 4-(4-formyl-N-[6-(4-formyl-N-(4-methoxyphenyl)anilino)-3,8-di(propan-2-yl)pyren-1-yl]anilino)-3-methylbenzaldehyde |
| SMILES | COc1ccc(N(c2ccc(C=O)cc2)c2cc(C(C)C)c3ccc4c(N(c5ccc(C=O)cc5)c5ccc(C=O)cc5C)cc(C(C)C)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C51H44N2O4/c1-31(2)45-26-48(52(37-12-7-34(28-54)8-13-37)38-16-18-40(57-6)19-17-38)43-22-20-42-46(32(3)4)27-49(44-23-21-41(45)50(43)51(42)44)53(39-14-9-35(29-55)10-15-39)47-24-11-36(30-56)25-33(47)5/h7-32H,1-6H3 |
| InChIKey | FTKZXAJOULLLCE-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.92 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|