C25H29F2N5O — CID 170727351
1-[5-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-2-pyridinyl]piperidine-4-carbaldehyde (PubChem CID 170727351) has the molecular formula C25H29F2N5O and a molecular weight of 453.54 g/mol. Its IUPAC name is 1-[5-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-2-pyridinyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[5-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-2-pyridinyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 170727351 |
| Molecular Formula | C25H29F2N5O |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 1-[5-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-2-pyridinyl]piperidine-4-carbaldehyde |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@H](c2ccc(N3CCC(C=O)CC3)nc2)N1CC(C)(F)F |
| InChI | InChI=1S/C25H29F2N5O/c1-16-11-20-19(4-5-22-21(20)13-29-30-22)24(32(16)15-25(2,26)27)18-3-6-23(28-12-18)31-9-7-17(14-33)8-10-31/h3-6,12-14,16-17,24H,7-11,15H2,1-2H3,(H,29,30)/t16-,24-/m1/s1 |
| InChIKey | RLVHOXVAVRYWBH-VOIUYBSRSA-N |
| XLogP | 4.36 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|