C14H23N3O3 — CID 170744863
(2S)-N-[(2S)-1-(ethylamino)-1-oxobut-3-yn-2-yl]-3-methyl-2-(propanoylamino)butanamide (PubChem CID 170744863) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(ethylamino)-1-oxobut-3-yn-2-yl]-3-methyl-2-(propanoylamino)butanamide.
| Compound Name | (2S)-N-[(2S)-1-(ethylamino)-1-oxobut-3-yn-2-yl]-3-methyl-2-(propanoylamino)butanamide |
|---|---|
| PubChem CID | 170744863 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | (2S)-N-[(2S)-1-(ethylamino)-1-oxobut-3-yn-2-yl]-3-methyl-2-(propanoylamino)butanamide |
| SMILES | C#C[C@H](NC(=O)[C@@H](NC(=O)CC)C(C)C)C(=O)NCC |
| InChI | InChI=1S/C14H23N3O3/c1-6-10(13(19)15-8-3)16-14(20)12(9(4)5)17-11(18)7-2/h1,9-10,12H,7-8H2,2-5H3,(H,15,19)(H,16,20)(H,17,18)/t10-,12-/m0/s1 |
| InChIKey | XKGJLQRUJYSOLA-JQWIXIFHSA-N |
| XLogP | -0.21 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|