C14H24NO3P — CID 170747388
6-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]-1-methyl-2,3,3a,4,7,7a-hexahydroindole (PubChem CID 170747388) has the molecular formula C14H24NO3P and a molecular weight of 285.32 g/mol. Its IUPAC name is 6-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]-1-methyl-2,3,3a,4,7,7a-hexahydroindole.
| Compound Name | 6-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]-1-methyl-2,3,3a,4,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 170747388 |
| Molecular Formula | C14H24NO3P |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 6-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]-1-methyl-2,3,3a,4,7,7a-hexahydroindole |
| SMILES | CN1CCC2CC=C(OP3OCC(C)(C)CO3)CC21 |
| InChI | InChI=1S/C14H24NO3P/c1-14(2)9-16-19(17-10-14)18-12-5-4-11-6-7-15(3)13(11)8-12/h5,11,13H,4,6-10H2,1-3H3 |
| InChIKey | SDAAYVSWBUJKEY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|