C21H30NO6P — CID 170747389
2-[[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,7,7a-tetrahydro-2H-indol-6-yl]oxy]-1,3,2λ5-dioxaphosphepane 2-oxide (PubChem CID 170747389) has the molecular formula C21H30NO6P and a molecular weight of 423.45 g/mol. Its IUPAC name is 2-[[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,7,7a-tetrahydro-2H-indol-6-yl]oxy]-1,3,2λ5-dioxaphosphepane 2-oxide.
| Compound Name | 2-[[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,7,7a-tetrahydro-2H-indol-6-yl]oxy]-1,3,2λ5-dioxaphosphepane 2-oxide |
|---|---|
| PubChem CID | 170747389 |
| Molecular Formula | C21H30NO6P |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,7,7a-tetrahydro-2H-indol-6-yl]oxy]-1,3,2λ5-dioxaphosphepane 2-oxide |
| SMILES | COc1ccc([C@@]23CC=C(OP4(=O)OCCCCO4)C[C@@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C21H30NO6P/c1-22-11-10-21(16-6-7-18(24-2)19(14-16)25-3)9-8-17(15-20(21)22)28-29(23)26-12-4-5-13-27-29/h6-8,14,20H,4-5,9-13,15H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | RPUSHQFZBVHBNG-SFTDATJTSA-N |
| XLogP | 4.28 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|