C21H23N3O3S — CID 170778236
[3-(3-cyclopropylpyrazolo[3,4-b]pyridin-1-yl)cyclobutyl]methyl 4-methylbenzenesulfonate (PubChem CID 170778236) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is [3-(3-cyclopropylpyrazolo[3,4-b]pyridin-1-yl)cyclobutyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3-(3-cyclopropylpyrazolo[3,4-b]pyridin-1-yl)cyclobutyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 170778236 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | [3-(3-cyclopropylpyrazolo[3,4-b]pyridin-1-yl)cyclobutyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(n3nc(C4CC4)c4cccnc43)C2)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-14-4-8-18(9-5-14)28(25,26)27-13-15-11-17(12-15)24-21-19(3-2-10-22-21)20(23-24)16-6-7-16/h2-5,8-10,15-17H,6-7,11-13H2,1H3 |
| InChIKey | FELQZKHKVQDIFS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|