C20H32BN3O6 — CID 170810572
methyl 1-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazole-5-carboxylate (PubChem CID 170810572) has the molecular formula C20H32BN3O6 and a molecular weight of 421.30 g/mol. Its IUPAC name is methyl 1-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazole-5-carboxylate.
| Compound Name | methyl 1-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 170810572 |
| Molecular Formula | C20H32BN3O6 |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | methyl 1-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)cnn1C |
| InChI | InChI=1S/C20H32BN3O6/c1-18(2,3)28-17(26)22-12-14(21-29-19(4,5)20(6,7)30-21)10-13-11-23-24(8)15(13)16(25)27-9/h10-11H,12H2,1-9H3,(H,22,26) |
| InChIKey | LGWVSGSQHCXGCN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|