C22H20N2O5S — CID 170833671
9H-fluoren-9-ylmethyl N-[3-(2-formyl-1,3-thiazol-4-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170833671) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2-formyl-1,3-thiazol-4-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2-formyl-1,3-thiazol-4-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170833671 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2-formyl-1,3-thiazol-4-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=Cc1nc(C(O)C(O)CNC(=O)OCC2c3ccccc3-c3ccccc32)cs1 |
| InChI | InChI=1S/C22H20N2O5S/c25-10-20-24-18(12-30-20)21(27)19(26)9-23-22(28)29-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,10,12,17,19,21,26-27H,9,11H2,(H,23,28) |
| InChIKey | STGBFJYAVBGCKE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|