C11H21NO8 — CID 170873987
(2R)-2-[(1R,2R,3R,4R)-1-amino-1-(1,3-dioxolan-2-yl)-3,4,5-trihydroxypentan-2-yl]oxypropanoic acid (PubChem CID 170873987) has the molecular formula C11H21NO8 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2R)-2-[(1R,2R,3R,4R)-1-amino-1-(1,3-dioxolan-2-yl)-3,4,5-trihydroxypentan-2-yl]oxypropanoic acid.
| Compound Name | (2R)-2-[(1R,2R,3R,4R)-1-amino-1-(1,3-dioxolan-2-yl)-3,4,5-trihydroxypentan-2-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 170873987 |
| Molecular Formula | C11H21NO8 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2R)-2-[(1R,2R,3R,4R)-1-amino-1-(1,3-dioxolan-2-yl)-3,4,5-trihydroxypentan-2-yl]oxypropanoic acid |
| SMILES | C[C@@H](O[C@@H]([C@H](O)[C@H](O)CO)[C@@H](N)C1OCCO1)C(=O)O |
| InChI | InChI=1S/C11H21NO8/c1-5(10(16)17)20-9(8(15)6(14)4-13)7(12)11-18-2-3-19-11/h5-9,11,13-15H,2-4,12H2,1H3,(H,16,17)/t5-,6-,7-,8-,9-/m1/s1 |
| InChIKey | CBZYFLKXUHGDNM-JGKVKWKGSA-N |
| XLogP | -2.74 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |