C26H24NO2+ — CID 170899065
5-[(E)-2-(1-ethylquinolin-1-ium-4-yl)ethenyl]-7,8-dihydro-6H-xanthen-3-ol (PubChem CID 170899065) has the molecular formula C26H24NO2+ and a molecular weight of 382.48 g/mol. Its IUPAC name is 5-[(E)-2-(1-ethylquinolin-1-ium-4-yl)ethenyl]-7,8-dihydro-6H-xanthen-3-ol.
| Compound Name | 5-[(E)-2-(1-ethylquinolin-1-ium-4-yl)ethenyl]-7,8-dihydro-6H-xanthen-3-ol |
|---|---|
| PubChem CID | 170899065 |
| Molecular Formula | C26H24NO2+ |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-[(E)-2-(1-ethylquinolin-1-ium-4-yl)ethenyl]-7,8-dihydro-6H-xanthen-3-ol |
| SMILES | CC[n+]1ccc(/C=C/C2=C3Oc4cc(O)ccc4C=C3CCC2)c2ccccc21 |
| InChI | InChI=1S/C26H23NO2/c1-2-27-15-14-18(23-8-3-4-9-24(23)27)10-11-19-6-5-7-21-16-20-12-13-22(28)17-25(20)29-26(19)21/h3-4,8-17H,2,5-7H2,1H3/p+1 |
| InChIKey | YTTXFRKKXYMNMN-UHFFFAOYSA-O |
| XLogP | 5.78 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|