C2H6BrN3O — CID 170906450
5-bromo-1,2,4-triazolidin-3-ol (PubChem CID 170906450) has the molecular formula C2H6BrN3O and a molecular weight of 167.99 g/mol. Its IUPAC name is 5-bromo-1,2,4-triazolidin-3-ol.
| Compound Name | 5-bromo-1,2,4-triazolidin-3-ol |
|---|---|
| PubChem CID | 170906450 |
| Molecular Formula | C2H6BrN3O |
| Molecular Weight | 167.99 g/mol |
| Exact Mass | 166.97 |
| IUPAC Name | 5-bromo-1,2,4-triazolidin-3-ol |
| SMILES | OC1NNC(Br)N1 |
| InChI | InChI=1S/C2H6BrN3O/c3-1-4-2(7)6-5-1/h1-2,4-7H |
| InChIKey | SBGGIEVIJMUSIQ-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.99 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|