C19H20ClN7O2 — CID 170960782
6-chloro-N-methoxy-4-[[(4S)-2,4,5-trimethyl-4H-[1,2,4]triazolo[1,5-a]quinoxalin-6-yl]amino]pyridine-3-carboxamide (PubChem CID 170960782) has the molecular formula C19H20ClN7O2 and a molecular weight of 413.87 g/mol. Its IUPAC name is 6-chloro-N-methoxy-4-[[(4S)-2,4,5-trimethyl-4H-[1,2,4]triazolo[1,5-a]quinoxalin-6-yl]amino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-methoxy-4-[[(4S)-2,4,5-trimethyl-4H-[1,2,4]triazolo[1,5-a]quinoxalin-6-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170960782 |
| Molecular Formula | C19H20ClN7O2 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 6-chloro-N-methoxy-4-[[(4S)-2,4,5-trimethyl-4H-[1,2,4]triazolo[1,5-a]quinoxalin-6-yl]amino]pyridine-3-carboxamide |
| SMILES | CONC(=O)c1cnc(Cl)cc1Nc1cccc2c1N(C)[C@@H](C)c1nc(C)nn1-2 |
| InChI | InChI=1S/C19H20ClN7O2/c1-10-18-22-11(2)24-27(18)15-7-5-6-13(17(15)26(10)3)23-14-8-16(20)21-9-12(14)19(28)25-29-4/h5-10H,1-4H3,(H,21,23)(H,25,28)/t10-/m0/s1 |
| InChIKey | NFHZUDXVIKVXCV-JTQLQIEISA-N |
| XLogP | 3.17 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|