C8H5Cl2FN2 — CID 170973422
2-(dichloromethyl)-7-fluoroimidazo[1,2-a]pyridine (PubChem CID 170973422) has the molecular formula C8H5Cl2FN2 and a molecular weight of 219.05 g/mol. Its IUPAC name is 2-(dichloromethyl)-7-fluoroimidazo[1,2-a]pyridine.
| Compound Name | 2-(dichloromethyl)-7-fluoroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 170973422 |
| Molecular Formula | C8H5Cl2FN2 |
| Molecular Weight | 219.05 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | 2-(dichloromethyl)-7-fluoroimidazo[1,2-a]pyridine |
| SMILES | Fc1ccn2cc(C(Cl)Cl)nc2c1 |
| InChI | InChI=1S/C8H5Cl2FN2/c9-8(10)6-4-13-2-1-5(11)3-7(13)12-6/h1-4,8H |
| InChIKey | GBJHJXMALUBEGC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.05 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|