C8H4Cl2F2N2 — CID 68763495
2-(dichloromethyl)-5,8-difluoroimidazo[1,2-a]pyridine (PubChem CID 68763495) has the molecular formula C8H4Cl2F2N2 and a molecular weight of 237.04 g/mol. Its IUPAC name is 2-(dichloromethyl)-5,8-difluoroimidazo[1,2-a]pyridine.
| Compound Name | 2-(dichloromethyl)-5,8-difluoroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 68763495 |
| Molecular Formula | C8H4Cl2F2N2 |
| Molecular Weight | 237.04 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 2-(dichloromethyl)-5,8-difluoroimidazo[1,2-a]pyridine |
| SMILES | Fc1ccc(F)n2cc(C(Cl)Cl)nc12 |
| InChI | InChI=1S/C8H4Cl2F2N2/c9-7(10)5-3-14-6(12)2-1-4(11)8(14)13-5/h1-3,7H |
| InChIKey | QIVVFSJBIHBBGO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.04 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|