C26H23NO5S — CID 170995342
(3E)-3-(3H-1,3-benzothiazol-2-ylidene)-6-(ethoxymethylidene)-4-(4-methoxyphenyl)-7,8-dihydro-4H-chromene-2,5-dione (PubChem CID 170995342) has the molecular formula C26H23NO5S and a molecular weight of 461.54 g/mol. Its IUPAC name is (3E)-3-(3H-1,3-benzothiazol-2-ylidene)-6-(ethoxymethylidene)-4-(4-methoxyphenyl)-7,8-dihydro-4H-chromene-2,5-dione.
| Compound Name | (3E)-3-(3H-1,3-benzothiazol-2-ylidene)-6-(ethoxymethylidene)-4-(4-methoxyphenyl)-7,8-dihydro-4H-chromene-2,5-dione |
|---|---|
| PubChem CID | 170995342 |
| Molecular Formula | C26H23NO5S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (3E)-3-(3H-1,3-benzothiazol-2-ylidene)-6-(ethoxymethylidene)-4-(4-methoxyphenyl)-7,8-dihydro-4H-chromene-2,5-dione |
| SMILES | CCOC=C1CCC2=C(C1=O)C(c1ccc(OC)cc1)/C(=C1/Nc3ccccc3S1)C(=O)O2 |
| InChI | InChI=1S/C26H23NO5S/c1-3-31-14-16-10-13-19-22(24(16)28)21(15-8-11-17(30-2)12-9-15)23(26(29)32-19)25-27-18-6-4-5-7-20(18)33-25/h4-9,11-12,14,21,27H,3,10,13H2,1-2H3/b16-14?,25-23+ |
| InChIKey | ZSFFRXCNRMZQMC-FAAFSAMASA-N |
| XLogP | 5.30 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|