C17H23Cl2N5O — CID 171106981
(1S)-4-[6-(2-aminopropyl)-5,7-dichloroimidazo[4,5-b]pyridin-3-yl]-N,2-dimethylcyclopentane-1-carboxamide (PubChem CID 171106981) has the molecular formula C17H23Cl2N5O and a molecular weight of 384.31 g/mol. Its IUPAC name is (1S)-4-[6-(2-aminopropyl)-5,7-dichloroimidazo[4,5-b]pyridin-3-yl]-N,2-dimethylcyclopentane-1-carboxamide.
| Compound Name | (1S)-4-[6-(2-aminopropyl)-5,7-dichloroimidazo[4,5-b]pyridin-3-yl]-N,2-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 171106981 |
| Molecular Formula | C17H23Cl2N5O |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (1S)-4-[6-(2-aminopropyl)-5,7-dichloroimidazo[4,5-b]pyridin-3-yl]-N,2-dimethylcyclopentane-1-carboxamide |
| SMILES | CNC(=O)[C@H]1CC(n2cnc3c(Cl)c(CC(C)N)c(Cl)nc32)CC1C |
| InChI | InChI=1S/C17H23Cl2N5O/c1-8-4-10(6-11(8)17(25)21-3)24-7-22-14-13(18)12(5-9(2)20)15(19)23-16(14)24/h7-11H,4-6,20H2,1-3H3,(H,21,25)/t8?,9?,10?,11-/m0/s1 |
| InChIKey | XVEPDSAHGQKPSX-QUBJWBRDSA-N |
| XLogP | 2.96 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|