C14H18BFO4S — CID 171111831
5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 171111831) has the molecular formula C14H18BFO4S and a molecular weight of 312.17 g/mol. Its IUPAC name is 5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 171111831 |
| Molecular Formula | C14H18BFO4S |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CC1(C)OB(C(F)=Cc2scc3c2OCCO3)OC1(C)C |
| InChI | InChI=1S/C14H18BFO4S/c1-13(2)14(3,4)20-15(19-13)11(16)7-10-12-9(8-21-10)17-5-6-18-12/h7-8H,5-6H2,1-4H3 |
| InChIKey | LUSMIBPJXDZHAM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|