C40H40N6O7S — CID 171322805
3-(1-benzothiophene-3-carbonyl)-16-(3-phenylprop-2-enoyl)-23-oxa-3,8,10,13,16,19-hexazatetracyclo[22.3.1.02,7.06,10]octacosa-1(28),6,8,24,26-pentaene-12,18-dione;formic acid (PubChem CID 171322805) has the molecular formula C40H40N6O7S and a molecular weight of 748.86 g/mol. Its IUPAC name is 3-(1-benzothiophene-3-carbonyl)-16-(3-phenylprop-2-enoyl)-23-oxa-3,8,10,13,16,19-hexazatetracyclo[22.3.1.02,7.06,10]octacosa-1(28),6,8,24,26-pentaene-12,18-dione;formic acid.
| Compound Name | 3-(1-benzothiophene-3-carbonyl)-16-(3-phenylprop-2-enoyl)-23-oxa-3,8,10,13,16,19-hexazatetracyclo[22.3.1.02,7.06,10]octacosa-1(28),6,8,24,26-pentaene-12,18-dione;formic acid |
|---|---|
| PubChem CID | 171322805 |
| Molecular Formula | C40H40N6O7S |
| Molecular Weight | 748.86 g/mol |
| Exact Mass | 748.27 |
| IUPAC Name | 3-(1-benzothiophene-3-carbonyl)-16-(3-phenylprop-2-enoyl)-23-oxa-3,8,10,13,16,19-hexazatetracyclo[22.3.1.02,7.06,10]octacosa-1(28),6,8,24,26-pentaene-12,18-dione;formic acid |
| SMILES | O=C1CN(C(=O)C=Cc2ccccc2)CCNC(=O)Cn2cnc3c2CCN(C(=O)c2csc4ccccc24)C3c2cccc(c2)OCCCN1.O=CO |
| InChI | InChI=1S/C39H38N6O5S.CH2O2/c46-34-23-43(36(48)15-14-27-8-2-1-3-9-27)20-18-41-35(47)24-44-26-42-37-32(44)16-19-45(39(49)31-25-51-33-13-5-4-12-30(31)33)38(37)28-10-6-11-29(22-28)50-21-7-17-40-34;2-1-3/h1-6,8-15,22,25-26,38H,7,16-21,23-24H2,(H,40,46)(H,41,47);1H,(H,2,3) |
| InChIKey | UVUKHOTVGNERBO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.86 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|