C12H16FN3O2S — CID 171323974
6-cyclobutyl-N-(1,1-dioxothiolan-3-yl)-5-fluoropyrimidin-4-amine (PubChem CID 171323974) has the molecular formula C12H16FN3O2S and a molecular weight of 285.34 g/mol. Its IUPAC name is 6-cyclobutyl-N-(1,1-dioxothiolan-3-yl)-5-fluoropyrimidin-4-amine.
| Compound Name | 6-cyclobutyl-N-(1,1-dioxothiolan-3-yl)-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 171323974 |
| Molecular Formula | C12H16FN3O2S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 6-cyclobutyl-N-(1,1-dioxothiolan-3-yl)-5-fluoropyrimidin-4-amine |
| SMILES | O=S1(=O)CCC(Nc2ncnc(C3CCC3)c2F)C1 |
| InChI | InChI=1S/C12H16FN3O2S/c13-10-11(8-2-1-3-8)14-7-15-12(10)16-9-4-5-19(17,18)6-9/h7-9H,1-6H2,(H,14,15,16) |
| InChIKey | OIVFZZSYKKTQBI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |