C23H28N6O2 — CID 171352104
1-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-(3-hydroxy-5-methylhex-1-ynyl)phenyl]urea (PubChem CID 171352104) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 1-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-(3-hydroxy-5-methylhex-1-ynyl)phenyl]urea.
| Compound Name | 1-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-(3-hydroxy-5-methylhex-1-ynyl)phenyl]urea |
|---|---|
| PubChem CID | 171352104 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-(3-hydroxy-5-methylhex-1-ynyl)phenyl]urea |
| SMILES | C/C(=N\N=C(N)N)c1ccc(NC(=O)Nc2ccc(C#CC(O)CC(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H28N6O2/c1-15(2)14-21(30)13-6-17-4-9-19(10-5-17)26-23(31)27-20-11-7-18(8-12-20)16(3)28-29-22(24)25/h4-5,7-12,15,21,30H,14H2,1-3H3,(H4,24,25,29)(H2,26,27,31)/b28-16+ |
| InChIKey | VXFKGRRJEMIYLP-LQKURTRISA-N |
| XLogP | 3.09 |
| TPSA | 138.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|