C10H11Cl2NO4S2 — CID 171357689
(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-amine (PubChem CID 171357689) has the molecular formula C10H11Cl2NO4S2 and a molecular weight of 344.24 g/mol. Its IUPAC name is (3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-amine.
| Compound Name | (3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 171357689 |
| Molecular Formula | C10H11Cl2NO4S2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | (3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-amine |
| SMILES | N[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO4S2/c11-7-2-1-6(3-8(7)12)19(16,17)10-5-18(14,15)4-9(10)13/h1-3,9-10H,4-5,13H2/t9-,10-/m0/s1 |
| InChIKey | YZJOCNGITLUBPN-UWVGGRQHSA-N |
| XLogP | 0.89 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |