C22H24O4 — CID 171358636
4-methyl-9-[(2E)-5-methyl-3-propylhexa-2,4-dienoxy]furo[3,2-g]chromen-7-one (PubChem CID 171358636) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-methyl-9-[(2E)-5-methyl-3-propylhexa-2,4-dienoxy]furo[3,2-g]chromen-7-one.
| Compound Name | 4-methyl-9-[(2E)-5-methyl-3-propylhexa-2,4-dienoxy]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 171358636 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 4-methyl-9-[(2E)-5-methyl-3-propylhexa-2,4-dienoxy]furo[3,2-g]chromen-7-one |
| SMILES | CCC/C(C=C(C)C)=C\COc1c2occc2c(C)c2ccc(=O)oc12 |
| InChI | InChI=1S/C22H24O4/c1-5-6-16(13-14(2)3)9-11-25-22-20-18(10-12-24-20)15(4)17-7-8-19(23)26-21(17)22/h7-10,12-13H,5-6,11H2,1-4H3/b16-9+ |
| InChIKey | OLAUAIDGXDXOCA-CXUHLZMHSA-N |
| XLogP | 5.92 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|